C11H24N2O2S — CID 167244428
tert-butyl N-(6-aminohexyl)-N-sulfanylcarbamate (PubChem CID 167244428) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is tert-butyl N-(6-aminohexyl)-N-sulfanylcarbamate.
| Compound Name | tert-butyl N-(6-aminohexyl)-N-sulfanylcarbamate |
|---|---|
| PubChem CID | 167244428 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | tert-butyl N-(6-aminohexyl)-N-sulfanylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(S)CCCCCCN |
| InChI | InChI=1S/C11H24N2O2S/c1-11(2,3)15-10(14)13(16)9-7-5-4-6-8-12/h16H,4-9,12H2,1-3H3 |
| InChIKey | BQYLSWSJDIVSEU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|