C20H40N2O4 — CID 91092434
ditert-butyl 2-amino-2-(9-aminononyl)propanedioate (PubChem CID 91092434) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is ditert-butyl 2-amino-2-(9-aminononyl)propanedioate.
| Compound Name | ditert-butyl 2-amino-2-(9-aminononyl)propanedioate |
|---|---|
| PubChem CID | 91092434 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | ditert-butyl 2-amino-2-(9-aminononyl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(CCCCCCCCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H40N2O4/c1-18(2,3)25-16(23)20(22,17(24)26-19(4,5)6)14-12-10-8-7-9-11-13-15-21/h7-15,21-22H2,1-6H3 |
| InChIKey | HXLRVPOTUOTDKD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|