C18H32N2O8 — CID 154136395
2,7-diamino-2,7-bis[(2-methylpropan-2-yl)oxycarbonyl]octanedioic acid (PubChem CID 154136395) has the molecular formula C18H32N2O8 and a molecular weight of 404.46 g/mol. Its IUPAC name is 2,7-diamino-2,7-bis[(2-methylpropan-2-yl)oxycarbonyl]octanedioic acid.
| Compound Name | 2,7-diamino-2,7-bis[(2-methylpropan-2-yl)oxycarbonyl]octanedioic acid |
|---|---|
| PubChem CID | 154136395 |
| Molecular Formula | C18H32N2O8 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2,7-diamino-2,7-bis[(2-methylpropan-2-yl)oxycarbonyl]octanedioic acid |
| SMILES | CC(C)(C)OC(=O)C(N)(CCCCC(N)(C(=O)O)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H32N2O8/c1-15(2,3)27-13(25)17(19,11(21)22)9-7-8-10-18(20,12(23)24)14(26)28-16(4,5)6/h7-10,19-20H2,1-6H3,(H,21,22)(H,23,24) |
| InChIKey | KYQKSGZTSAMYBG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 179.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|