C10H18N2O5 — CID 150911760
(2S)-2-amino-4-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxobutanoic acid (PubChem CID 150911760) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is (2S)-2-amino-4-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 150911760 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (2S)-2-amino-4-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxobutanoic acid |
| SMILES | CNC(=O)C[C@](N)(C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18N2O5/c1-9(2,3)17-8(16)10(11,7(14)15)5-6(13)12-4/h5,11H2,1-4H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChIKey | LCDGYGOPPOBXHB-JTQLQIEISA-N |
| XLogP | -0.75 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|