C13H25NO4 — CID 151039788
2-amino-5,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid (PubChem CID 151039788) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-amino-5,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid.
| Compound Name | 2-amino-5,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid |
|---|---|
| PubChem CID | 151039788 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-amino-5,5-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]hexanoic acid |
| SMILES | CC(C)(C)CCC(N)(C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO4/c1-11(2,3)7-8-13(14,9(15)16)10(17)18-12(4,5)6/h7-8,14H2,1-6H3,(H,15,16) |
| InChIKey | MBVLQMNRPRVSIR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|