C11H22N2O4 — CID 141461632
(2S)-2,6-diamino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylhexanoic acid (PubChem CID 141461632) has the molecular formula C11H22N2O4 and a molecular weight of 247.31 g/mol. Its IUPAC name is (2S)-2,6-diamino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylhexanoic acid.
| Compound Name | (2S)-2,6-diamino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylhexanoic acid |
|---|---|
| PubChem CID | 141461632 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2S)-2,6-diamino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylhexanoic acid |
| SMILES | [2H]CC(C)(C)OC(=O)[C@](N)(CCCCN)C(=O)O |
| InChI | InChI=1S/C11H22N2O4/c1-10(2,3)17-9(16)11(13,8(14)15)6-4-5-7-12/h4-7,12-13H2,1-3H3,(H,14,15)/t11-/m0/s1/i1D |
| InChIKey | UJAXSMBQBPJDHB-YUGCEPSCSA-N |
| XLogP | 0.24 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|