C10H16N2O4 — CID 177255023
2,6-diamino-2-prop-2-ynoxycarbonylhexanoic acid (PubChem CID 177255023) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2,6-diamino-2-prop-2-ynoxycarbonylhexanoic acid.
| Compound Name | 2,6-diamino-2-prop-2-ynoxycarbonylhexanoic acid |
|---|---|
| PubChem CID | 177255023 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2,6-diamino-2-prop-2-ynoxycarbonylhexanoic acid |
| SMILES | C#CCOC(=O)C(N)(CCCCN)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-2-7-16-9(15)10(12,8(13)14)5-3-4-6-11/h1H,3-7,11-12H2,(H,13,14) |
| InChIKey | UXEAOQMHLXORFN-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|