About bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate
bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate (PubChem CID 130209955) has the molecular formula C10H9FO4
and a molecular weight of 212.18 g/mol. Its IUPAC name is bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate.
Molecular Properties
| Compound Name | bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate |
| PubChem CID | 130209955 |
| Molecular Formula | C10H9FO4 |
| Molecular Weight | 212.18 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate |
| SMILES | C#CCOC(=O)C(C)(F)C(=O)OCC#C |
| InChI | InChI=1S/C10H9FO4/c1-4-6-14-8(12)10(3,11)9(13)15-7-5-2/h1-2H,6-7H2,3H3 |
| InChIKey | STZVXDWKEOEVLE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate?
The IUPAC name of bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate (CID 130209955) is bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate.
What is the SMILES notation for bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate?
The canonical SMILES for bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate is C#CCOC(=O)C(C)(F)C(=O)OCC#C.
What is the InChIKey of bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate?
The InChIKey is STZVXDWKEOEVLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO4/c1-4-6-14-8(12)10(3,11)9(13)15-7-5-2/h1-2H,6-7H2,3H3.
What are the key properties of bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate?
bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate has a molecular weight of 212.18 g/mol, XLogP of 0.07, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-ynyl) 2-fluoro-2-methylpropanedioate is sourced from PubChem (CID 130209955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).