About prop-2-ynyl 2-acetamidoacetate
prop-2-ynyl 2-acetamidoacetate (PubChem CID 131210561) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is prop-2-ynyl 2-acetamidoacetate.
Molecular Properties
| Compound Name | prop-2-ynyl 2-acetamidoacetate |
| PubChem CID | 131210561 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | prop-2-ynyl 2-acetamidoacetate |
| SMILES | C#CCOC(=O)CNC(C)=O |
| InChI | InChI=1S/C7H9NO3/c1-3-4-11-7(10)5-8-6(2)9/h1H,4-5H2,2H3,(H,8,9) |
| InChIKey | MFAANPVETFOHMD-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 2-acetamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 2-acetamidoacetate?
The IUPAC name of prop-2-ynyl 2-acetamidoacetate (CID 131210561) is prop-2-ynyl 2-acetamidoacetate.
What is the SMILES notation for prop-2-ynyl 2-acetamidoacetate?
The canonical SMILES for prop-2-ynyl 2-acetamidoacetate is C#CCOC(=O)CNC(C)=O.
What is the InChIKey of prop-2-ynyl 2-acetamidoacetate?
The InChIKey is MFAANPVETFOHMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-3-4-11-7(10)5-8-6(2)9/h1H,4-5H2,2H3,(H,8,9).
What are the key properties of prop-2-ynyl 2-acetamidoacetate?
prop-2-ynyl 2-acetamidoacetate has a molecular weight of 155.15 g/mol, XLogP of -0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 2-acetamidoacetate is sourced from PubChem (CID 131210561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).