methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate

C9H12O5 — CID 88550304

IUPACmethyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate
SMILESC#CCOC(=O)OC(C)(C)C(=O)OC
InChIInChI=1S/C9H12O5/c1-5-6-13-8(11)14-9(2,3)7(10)12-4/h1H,6H2,2-4H3
InChIKeyXDONLTBTSAGXEJ-UHFFFAOYSA-N
MW200.19 g/mol
LogP0.72
Rot. Bonds3

About methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate

methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate (PubChem CID 88550304) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate.

Molecular Properties

Compound Namemethyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate
PubChem CID88550304
Molecular FormulaC9H12O5
Molecular Weight200.19 g/mol
Exact Mass200.07
IUPAC Namemethyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate
SMILESC#CCOC(=O)OC(C)(C)C(=O)OC
InChIInChI=1S/C9H12O5/c1-5-6-13-8(11)14-9(2,3)7(10)12-4/h1H,6H2,2-4H3
InChIKeyXDONLTBTSAGXEJ-UHFFFAOYSA-N
XLogP0.72
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.19
LogP ≤ 50.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate?
The IUPAC name of methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate (CID 88550304) is methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate.
What is the SMILES notation for methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate?
The canonical SMILES for methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate is C#CCOC(=O)OC(C)(C)C(=O)OC.
What is the InChIKey of methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate?
The InChIKey is XDONLTBTSAGXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5/c1-5-6-13-8(11)14-9(2,3)7(10)12-4/h1H,6H2,2-4H3.
What are the key properties of methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate?
methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate has a molecular weight of 200.19 g/mol, XLogP of 0.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-2-prop-2-ynoxycarbonyloxypropanoate is sourced from PubChem (CID 88550304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).