C11H19NO4 — CID 169450266
N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]acetamide (PubChem CID 169450266) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]acetamide.
| Compound Name | N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 169450266 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethyl]acetamide |
| SMILES | C#CCOCCOCCOCCNC(C)=O |
| InChI | InChI=1S/C11H19NO4/c1-3-5-14-7-9-16-10-8-15-6-4-12-11(2)13/h1H,4-10H2,2H3,(H,12,13) |
| InChIKey | RBBWRTAXOCVYGT-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|