C13H23NO3 — CID 156733351
4-methyl-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide (PubChem CID 156733351) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 4-methyl-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide.
| Compound Name | 4-methyl-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 156733351 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 4-methyl-N-[2-(2-prop-2-ynoxyethoxy)ethyl]pentanamide |
| SMILES | C#CCOCCOCCNC(=O)CCC(C)C |
| InChI | InChI=1S/C13H23NO3/c1-4-8-16-10-11-17-9-7-14-13(15)6-5-12(2)3/h1,12H,5-11H2,2-3H3,(H,14,15) |
| InChIKey | XJTMNHRVGHGQMJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|