C11H18N4O2 — CID 91332449
4-azido-N-(2-prop-2-ynoxyethyl)hexanamide (PubChem CID 91332449) has the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-azido-N-(2-prop-2-ynoxyethyl)hexanamide.
| Compound Name | 4-azido-N-(2-prop-2-ynoxyethyl)hexanamide |
|---|---|
| PubChem CID | 91332449 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 4-azido-N-(2-prop-2-ynoxyethyl)hexanamide |
| SMILES | C#CCOCCNC(=O)CCC(CC)N=[N+]=[N-] |
| InChI | InChI=1S/C11H18N4O2/c1-3-8-17-9-7-13-11(16)6-5-10(4-2)14-15-12/h1,10H,4-9H2,2H3,(H,13,16) |
| InChIKey | MPSLZRNABHKBPT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|