C13H27N5O2 — CID 166868802
tert-butyl N-[2-[3-azidopentyl(methyl)amino]ethyl]carbamate (PubChem CID 166868802) has the molecular formula C13H27N5O2 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl N-[2-[3-azidopentyl(methyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-azidopentyl(methyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 166868802 |
| Molecular Formula | C13H27N5O2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | tert-butyl N-[2-[3-azidopentyl(methyl)amino]ethyl]carbamate |
| SMILES | CCC(CCN(C)CCNC(=O)OC(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C13H27N5O2/c1-6-11(16-17-14)7-9-18(5)10-8-15-12(19)20-13(2,3)4/h11H,6-10H2,1-5H3,(H,15,19) |
| InChIKey | NUIXOTNGWCBPCV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|