C15H31N3O4S — CID 170123968
N-(3-methylbutyl)-3-[2-[3-[2-(sulfanylamino)ethoxy]propanoylamino]ethoxy]propanamide (PubChem CID 170123968) has the molecular formula C15H31N3O4S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-(3-methylbutyl)-3-[2-[3-[2-(sulfanylamino)ethoxy]propanoylamino]ethoxy]propanamide.
| Compound Name | N-(3-methylbutyl)-3-[2-[3-[2-(sulfanylamino)ethoxy]propanoylamino]ethoxy]propanamide |
|---|---|
| PubChem CID | 170123968 |
| Molecular Formula | C15H31N3O4S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N-(3-methylbutyl)-3-[2-[3-[2-(sulfanylamino)ethoxy]propanoylamino]ethoxy]propanamide |
| SMILES | CC(C)CCNC(=O)CCOCCNC(=O)CCOCCNS |
| InChI | InChI=1S/C15H31N3O4S/c1-13(2)3-6-16-14(19)4-9-21-11-7-17-15(20)5-10-22-12-8-18-23/h13,18,23H,3-12H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | GKWFCJBCYFXMRA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|