C7H5F6NO2 — CID 71672160
prop-2-ynyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate (PubChem CID 71672160) has the molecular formula C7H5F6NO2 and a molecular weight of 249.11 g/mol. Its IUPAC name is prop-2-ynyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate.
| Compound Name | prop-2-ynyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
|---|---|
| PubChem CID | 71672160 |
| Molecular Formula | C7H5F6NO2 |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | prop-2-ynyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
| SMILES | C#CCOC(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F6NO2/c1-2-3-16-5(15)14-4(6(8,9)10)7(11,12)13/h1,4H,3H2,(H,14,15) |
| InChIKey | LMGQDBGZUVSHFY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|