C5H5F6NO2 — CID 23234717
methyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate (PubChem CID 23234717) has the molecular formula C5H5F6NO2 and a molecular weight of 225.09 g/mol. Its IUPAC name is methyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate.
| Compound Name | methyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
|---|---|
| PubChem CID | 23234717 |
| Molecular Formula | C5H5F6NO2 |
| Molecular Weight | 225.09 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | methyl N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
| SMILES | COC(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H5F6NO2/c1-14-3(13)12-2(4(6,7)8)5(9,10)11/h2H,1H3,(H,12,13) |
| InChIKey | FWUIQXHSQDQMQU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.09 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |