C9H17NO3 — CID 58257381
methyl N-[(3R)-2,2-dimethyl-4-oxopentan-3-yl]carbamate (PubChem CID 58257381) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is methyl N-[(3R)-2,2-dimethyl-4-oxopentan-3-yl]carbamate.
| Compound Name | methyl N-[(3R)-2,2-dimethyl-4-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 58257381 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | methyl N-[(3R)-2,2-dimethyl-4-oxopentan-3-yl]carbamate |
| SMILES | COC(=O)N[C@@H](C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C9H17NO3/c1-6(11)7(9(2,3)4)10-8(12)13-5/h7H,1-5H3,(H,10,12)/t7-/m0/s1 |
| InChIKey | FBINZGLGIAVDJE-ZETCQYMHSA-N |
| XLogP | 1.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |