C13H25NO2 — CID 123936360
tert-butyl N-(2,4,4-trimethylpent-1-en-3-yl)carbamate (PubChem CID 123936360) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is tert-butyl N-(2,4,4-trimethylpent-1-en-3-yl)carbamate.
| Compound Name | tert-butyl N-(2,4,4-trimethylpent-1-en-3-yl)carbamate |
|---|---|
| PubChem CID | 123936360 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | tert-butyl N-(2,4,4-trimethylpent-1-en-3-yl)carbamate |
| SMILES | C=C(C)C(NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-9(2)10(12(3,4)5)14-11(15)16-13(6,7)8/h10H,1H2,2-8H3,(H,14,15) |
| InChIKey | CUNAHIALCRMOLE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|