C16H35NO3 — CID 145466117
tert-butyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate;ethane (PubChem CID 145466117) has the molecular formula C16H35NO3 and a molecular weight of 289.46 g/mol. Its IUPAC name is tert-butyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate;ethane.
| Compound Name | tert-butyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate;ethane |
|---|---|
| PubChem CID | 145466117 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | tert-butyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate;ethane |
| SMILES | CC.CC.CC(=O)C(NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H23NO3.2C2H6/c1-8(14)9(11(2,3)4)13-10(15)16-12(5,6)7;2*1-2/h9H,1-7H3,(H,13,15);2*1-2H3 |
| InChIKey | KOYFLGHFSLXCMM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |