C9H16BrNO2 — CID 166659302
tert-butyl N-(3-bromobut-3-en-2-yl)carbamate (PubChem CID 166659302) has the molecular formula C9H16BrNO2 and a molecular weight of 250.14 g/mol. Its IUPAC name is tert-butyl N-(3-bromobut-3-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(3-bromobut-3-en-2-yl)carbamate |
|---|---|
| PubChem CID | 166659302 |
| Molecular Formula | C9H16BrNO2 |
| Molecular Weight | 250.14 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | tert-butyl N-(3-bromobut-3-en-2-yl)carbamate |
| SMILES | C=C(Br)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H16BrNO2/c1-6(10)7(2)11-8(12)13-9(3,4)5/h7H,1H2,2-5H3,(H,11,12) |
| InChIKey | JKSKWJOAZDQITH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |