C12H23NO3S — CID 162514710
O-tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate (PubChem CID 162514710) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is O-tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate.
| Compound Name | O-tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
|---|---|
| PubChem CID | 162514710 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | O-tert-butyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanethioate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=S)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO3S/c1-8(9(17)15-11(2,3)4)13-10(14)16-12(5,6)7/h8H,1-7H3,(H,13,14)/t8-/m1/s1 |
| InChIKey | DYUVZXXQMKAFAF-MRVPVSSYSA-N |
| XLogP | 3.04 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|