C11H20N2O2S — CID 134600236
tert-butyl N-[(2R)-3-(1-aminoethenylsulfanyl)but-3-en-2-yl]carbamate (PubChem CID 134600236) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-(1-aminoethenylsulfanyl)but-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-(1-aminoethenylsulfanyl)but-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 134600236 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | tert-butyl N-[(2R)-3-(1-aminoethenylsulfanyl)but-3-en-2-yl]carbamate |
| SMILES | C=C(N)SC(=C)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20N2O2S/c1-7(8(2)16-9(3)12)13-10(14)15-11(4,5)6/h7H,2-3,12H2,1,4-6H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | RFVQVIWEEONWKI-SSDOTTSWSA-N |
| XLogP | 2.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |