C13H23NO3 — CID 90718050
pent-4-enyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate (PubChem CID 90718050) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is pent-4-enyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate.
| Compound Name | pent-4-enyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate |
|---|---|
| PubChem CID | 90718050 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | pent-4-enyl N-(2,2-dimethyl-4-oxopentan-3-yl)carbamate |
| SMILES | C=CCCCOC(=O)NC(C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C13H23NO3/c1-6-7-8-9-17-12(16)14-11(10(2)15)13(3,4)5/h6,11H,1,7-9H2,2-5H3,(H,14,16) |
| InChIKey | VGXMVBUSGBHAMU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|