2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid

C13H23NO4 — CID 75113125

IUPAC2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid
SMILESC=CCCCCOC(=O)NC(C(=O)O)C(C)(C)C
InChIInChI=1S/C13H23NO4/c1-5-6-7-8-9-18-12(17)14-10(11(15)16)13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,14,17)(H,15,16)
InChIKeyHGLGPVAXXFHTGG-UHFFFAOYSA-N
MW257.33 g/mol
LogP2.57
Rot. Bonds7

About 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid

2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid (PubChem CID 75113125) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid
PubChem CID75113125
Molecular FormulaC13H23NO4
Molecular Weight257.33 g/mol
Exact Mass257.16
IUPAC Name2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid
SMILESC=CCCCCOC(=O)NC(C(=O)O)C(C)(C)C
InChIInChI=1S/C13H23NO4/c1-5-6-7-8-9-18-12(17)14-10(11(15)16)13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,14,17)(H,15,16)
InChIKeyHGLGPVAXXFHTGG-UHFFFAOYSA-N
XLogP2.57
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.33
LogP ≤ 52.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid?
The IUPAC name of 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid (CID 75113125) is 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid is C=CCCCCOC(=O)NC(C(=O)O)C(C)(C)C.
What is the InChIKey of 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid?
The InChIKey is HGLGPVAXXFHTGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4/c1-5-6-7-8-9-18-12(17)14-10(11(15)16)13(2,3)4/h5,10H,1,6-9H2,2-4H3,(H,14,17)(H,15,16).
What are the key properties of 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid?
2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid has a molecular weight of 257.33 g/mol, XLogP of 2.57, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hex-5-enoxycarbonylamino)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 75113125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).