C19H31NO4 — CID 123818101
3,3-dimethyl-2-[(2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl)oxycarbonylamino]butanoic acid (PubChem CID 123818101) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl)oxycarbonylamino]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[(2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 123818101 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 3,3-dimethyl-2-[(2-pent-4-enyl-3-bicyclo[3.1.1]heptanyl)oxycarbonylamino]butanoic acid |
| SMILES | C=CCCCC1C2CC(C2)CC1OC(=O)NC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H31NO4/c1-5-6-7-8-14-13-9-12(10-13)11-15(14)24-18(23)20-16(17(21)22)19(2,3)4/h5,12-16H,1,6-11H2,2-4H3,(H,20,23)(H,21,22) |
| InChIKey | BFQXHXRMRQHCMV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|