C16H25NO4 — CID 118983364
(2S)-2-cyclopentyl-2-[[(1R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]acetic acid (PubChem CID 118983364) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-2-cyclopentyl-2-[[(1R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]acetic acid.
| Compound Name | (2S)-2-cyclopentyl-2-[[(1R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 118983364 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (2S)-2-cyclopentyl-2-[[(1R)-2-pent-4-enylcyclopropyl]oxycarbonylamino]acetic acid |
| SMILES | C=CCCCC1C[C@H]1OC(=O)N[C@H](C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C16H25NO4/c1-2-3-4-9-12-10-13(12)21-16(20)17-14(15(18)19)11-7-5-6-8-11/h2,11-14H,1,3-10H2,(H,17,20)(H,18,19)/t12?,13-,14+/m1/s1 |
| InChIKey | PHJZGYPXNNZEAD-IUZLNWEFSA-N |
| XLogP | 3.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|