C17H27NO5 — CID 68664954
(2S)-2-cyclohexyl-2-[[(1R,2R)-2-prop-2-enoxycyclopentyl]oxycarbonylamino]acetic acid (PubChem CID 68664954) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S)-2-cyclohexyl-2-[[(1R,2R)-2-prop-2-enoxycyclopentyl]oxycarbonylamino]acetic acid.
| Compound Name | (2S)-2-cyclohexyl-2-[[(1R,2R)-2-prop-2-enoxycyclopentyl]oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 68664954 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2S)-2-cyclohexyl-2-[[(1R,2R)-2-prop-2-enoxycyclopentyl]oxycarbonylamino]acetic acid |
| SMILES | C=CCO[C@@H]1CCC[C@H]1OC(=O)N[C@H](C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C17H27NO5/c1-2-11-22-13-9-6-10-14(13)23-17(21)18-15(16(19)20)12-7-4-3-5-8-12/h2,12-15H,1,3-11H2,(H,18,21)(H,19,20)/t13-,14-,15+/m1/s1 |
| InChIKey | JQTMDJRBZNLEMY-KFWWJZLASA-N |
| XLogP | 2.87 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|