C16H27NO4 — CID 66782617
2-cyclohexyl-2-(hept-6-enoxycarbonylamino)acetic acid (PubChem CID 66782617) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-cyclohexyl-2-(hept-6-enoxycarbonylamino)acetic acid.
| Compound Name | 2-cyclohexyl-2-(hept-6-enoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 66782617 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-cyclohexyl-2-(hept-6-enoxycarbonylamino)acetic acid |
| SMILES | C=CCCCCCOC(=O)NC(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C16H27NO4/c1-2-3-4-5-9-12-21-16(20)17-14(15(18)19)13-10-7-6-8-11-13/h2,13-14H,1,3-12H2,(H,17,20)(H,18,19) |
| InChIKey | DAVHCOGLHDMONO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|