C17H29NO4 — CID 59287148
(2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoic acid (PubChem CID 59287148) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 59287148 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[[(1R,2R)-2-pent-4-enylcyclopentyl]oxycarbonylamino]butanoic acid |
| SMILES | C=CCCC[C@@H]1CCC[C@H]1OC(=O)N[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H29NO4/c1-5-6-7-9-12-10-8-11-13(12)22-16(21)18-14(15(19)20)17(2,3)4/h5,12-14H,1,6-11H2,2-4H3,(H,18,21)(H,19,20)/t12-,13-,14-/m1/s1 |
| InChIKey | NDNVHBOKJUZBEG-MGPQQGTHSA-N |
| XLogP | 3.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|