C12H23NO2 — CID 58005101
(2S)-2-(hex-5-enylamino)-3,3-dimethylbutanoic acid (PubChem CID 58005101) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is (2S)-2-(hex-5-enylamino)-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-(hex-5-enylamino)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 58005101 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | (2S)-2-(hex-5-enylamino)-3,3-dimethylbutanoic acid |
| SMILES | C=CCCCCN[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-5-6-7-8-9-13-10(11(14)15)12(2,3)4/h5,10,13H,1,6-9H2,2-4H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | HKLKEXCRUXRTKF-SNVBAGLBSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|