C14H26N2O3 — CID 149018278
(2S)-3,3-dimethyl-2-[[2-[methyl(pent-4-enyl)amino]-2-oxoethyl]amino]butanoic acid (PubChem CID 149018278) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2S)-3,3-dimethyl-2-[[2-[methyl(pent-4-enyl)amino]-2-oxoethyl]amino]butanoic acid.
| Compound Name | (2S)-3,3-dimethyl-2-[[2-[methyl(pent-4-enyl)amino]-2-oxoethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 149018278 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | (2S)-3,3-dimethyl-2-[[2-[methyl(pent-4-enyl)amino]-2-oxoethyl]amino]butanoic acid |
| SMILES | C=CCCCN(C)C(=O)CN[C@H](C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O3/c1-6-7-8-9-16(5)11(17)10-15-12(13(18)19)14(2,3)4/h6,12,15H,1,7-10H2,2-5H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | QCYXPBSJDBVAHS-GFCCVEGCSA-N |
| XLogP | 1.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|