C11H22N2O — CID 15511724
(2S)-2-amino-N,3-dimethyl-N-pent-4-enylbutanamide (PubChem CID 15511724) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is (2S)-2-amino-N,3-dimethyl-N-pent-4-enylbutanamide.
| Compound Name | (2S)-2-amino-N,3-dimethyl-N-pent-4-enylbutanamide |
|---|---|
| PubChem CID | 15511724 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | (2S)-2-amino-N,3-dimethyl-N-pent-4-enylbutanamide |
| SMILES | C=CCCCN(C)C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C11H22N2O/c1-5-6-7-8-13(4)11(14)10(12)9(2)3/h5,9-10H,1,6-8,12H2,2-4H3/t10-/m0/s1 |
| InChIKey | NPAYRMRXDKZFNQ-JTQLQIEISA-N |
| XLogP | 1.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|