C11H24N2O2 — CID 143701294
2-amino-N,3-dimethyl-N-(2-oxopropyl)butanamide;ethane (PubChem CID 143701294) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-amino-N,3-dimethyl-N-(2-oxopropyl)butanamide;ethane.
| Compound Name | 2-amino-N,3-dimethyl-N-(2-oxopropyl)butanamide;ethane |
|---|---|
| PubChem CID | 143701294 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-amino-N,3-dimethyl-N-(2-oxopropyl)butanamide;ethane |
| SMILES | CC.CC(=O)CN(C)C(=O)C(N)C(C)C |
| InChI | InChI=1S/C9H18N2O2.C2H6/c1-6(2)8(10)9(13)11(4)5-7(3)12;1-2/h6,8H,5,10H2,1-4H3;1-2H3 |
| InChIKey | QNAQIKDCJHQCOH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |