C11H21N3O3 — CID 123597331
2-amino-N,3-dimethyl-N-[2-oxo-2-(1-oxopropan-2-ylamino)ethyl]butanamide (PubChem CID 123597331) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-amino-N,3-dimethyl-N-[2-oxo-2-(1-oxopropan-2-ylamino)ethyl]butanamide.
| Compound Name | 2-amino-N,3-dimethyl-N-[2-oxo-2-(1-oxopropan-2-ylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 123597331 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-amino-N,3-dimethyl-N-[2-oxo-2-(1-oxopropan-2-ylamino)ethyl]butanamide |
| SMILES | CC(C=O)NC(=O)CN(C)C(=O)C(N)C(C)C |
| InChI | InChI=1S/C11H21N3O3/c1-7(2)10(12)11(17)14(4)5-9(16)13-8(3)6-15/h6-8,10H,5,12H2,1-4H3,(H,13,16) |
| InChIKey | GQGHEFGBOVSLHB-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|