C11H22N2O2 — CID 142876722
2-amino-N-[(E)-3-methoxybut-2-enyl]-N,3-dimethylbutanamide (PubChem CID 142876722) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-amino-N-[(E)-3-methoxybut-2-enyl]-N,3-dimethylbutanamide.
| Compound Name | 2-amino-N-[(E)-3-methoxybut-2-enyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 142876722 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-amino-N-[(E)-3-methoxybut-2-enyl]-N,3-dimethylbutanamide |
| SMILES | CO/C(C)=C/CN(C)C(=O)C(N)C(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-8(2)10(12)11(14)13(4)7-6-9(3)15-5/h6,8,10H,7,12H2,1-5H3/b9-6+ |
| InChIKey | IDHPKEGFDLPBFE-RMKNXTFCSA-N |
| XLogP | 0.98 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|