C15H27N3O2 — CID 143023563
2-amino-N,3-dimethyl-N-[(E)-3-methyl-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]butanamide (PubChem CID 143023563) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-amino-N,3-dimethyl-N-[(E)-3-methyl-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]butanamide.
| Compound Name | 2-amino-N,3-dimethyl-N-[(E)-3-methyl-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]butanamide |
|---|---|
| PubChem CID | 143023563 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 2-amino-N,3-dimethyl-N-[(E)-3-methyl-4-oxo-4-pyrrolidin-1-ylbut-2-enyl]butanamide |
| SMILES | C/C(=C\CN(C)C(=O)C(N)C(C)C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C15H27N3O2/c1-11(2)13(16)15(20)17(4)10-7-12(3)14(19)18-8-5-6-9-18/h7,11,13H,5-6,8-10,16H2,1-4H3/b12-7+ |
| InChIKey | SMJOMKIRXSUHNW-KPKJPENVSA-N |
| XLogP | 1.00 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|