C10H22N2O — CID 43272154
2-amino-N,3-dimethyl-N-(2-methylpropyl)butanamide (PubChem CID 43272154) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-amino-N,3-dimethyl-N-(2-methylpropyl)butanamide.
| Compound Name | 2-amino-N,3-dimethyl-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 43272154 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-amino-N,3-dimethyl-N-(2-methylpropyl)butanamide |
| SMILES | CC(C)CN(C)C(=O)C(N)C(C)C |
| InChI | InChI=1S/C10H22N2O/c1-7(2)6-12(5)10(13)9(11)8(3)4/h7-9H,6,11H2,1-5H3 |
| InChIKey | DOVGJJSQKXBKAX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |