C14H30N2O4 — CID 119303457
(2S)-2-amino-N-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-N,3-dimethylbutanamide (PubChem CID 119303457) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-N,3-dimethylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 119303457 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (2S)-2-amino-N-[2-hydroxy-3-(2-propan-2-yloxyethoxy)propyl]-N,3-dimethylbutanamide |
| SMILES | CC(C)OCCOCC(O)CN(C)C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C14H30N2O4/c1-10(2)13(15)14(18)16(5)8-12(17)9-19-6-7-20-11(3)4/h10-13,17H,6-9,15H2,1-5H3/t12?,13-/m0/s1 |
| InChIKey | UTOQXWPMAGMRMK-ABLWVSNPSA-N |
| XLogP | 0.23 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|