C12H30N2O2 — CID 145302166
2-amino-3-methyl-N-(1-oxopropan-2-yl)butanamide;butane;molecular hydrogen (PubChem CID 145302166) has the molecular formula C12H30N2O2 and a molecular weight of 234.38 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(1-oxopropan-2-yl)butanamide;butane;molecular hydrogen.
| Compound Name | 2-amino-3-methyl-N-(1-oxopropan-2-yl)butanamide;butane;molecular hydrogen |
|---|---|
| PubChem CID | 145302166 |
| Molecular Formula | C12H30N2O2 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 2-amino-3-methyl-N-(1-oxopropan-2-yl)butanamide;butane;molecular hydrogen |
| SMILES | CC(C=O)NC(=O)C(N)C(C)C.CCCC.[H][H].[H][H] |
| InChI | InChI=1S/C8H16N2O2.C4H10.2H2/c1-5(2)7(9)8(12)10-6(3)4-11;1-3-4-2;;/h4-7H,9H2,1-3H3,(H,10,12);3-4H2,1-2H3;2*1H |
| InChIKey | NCQMDUAHTHHTPL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|