C11H24N2O2 — CID 142449079
ethane;N-(1-oxopropan-2-yl)-2-(propylamino)propanamide (PubChem CID 142449079) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is ethane;N-(1-oxopropan-2-yl)-2-(propylamino)propanamide.
| Compound Name | ethane;N-(1-oxopropan-2-yl)-2-(propylamino)propanamide |
|---|---|
| PubChem CID | 142449079 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | ethane;N-(1-oxopropan-2-yl)-2-(propylamino)propanamide |
| SMILES | CC.CCCNC(C)C(=O)NC(C)C=O |
| InChI | InChI=1S/C9H18N2O2.C2H6/c1-4-5-10-8(3)9(13)11-7(2)6-12;1-2/h6-8,10H,4-5H2,1-3H3,(H,11,13);1-2H3 |
| InChIKey | IJBCMGXTQDFXRO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|