C9H18N4O3 — CID 11949429
2,3-diamino-N-[(2S)-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]propan-2-yl]propanamide (PubChem CID 11949429) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2,3-diamino-N-[(2S)-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]propan-2-yl]propanamide.
| Compound Name | 2,3-diamino-N-[(2S)-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]propan-2-yl]propanamide |
|---|---|
| PubChem CID | 11949429 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2,3-diamino-N-[(2S)-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]propan-2-yl]propanamide |
| SMILES | C[C@H](NC(=O)C(N)CN)C(=O)N[C@@H](C)C=O |
| InChI | InChI=1S/C9H18N4O3/c1-5(4-14)12-8(15)6(2)13-9(16)7(11)3-10/h4-7H,3,10-11H2,1-2H3,(H,12,15)(H,13,16)/t5-,6-,7?/m0/s1 |
| InChIKey | LOPVYLSJXBTFER-WABBHOIFSA-N |
| XLogP | -2.52 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|