C8H18N2NaO3P — CID 174273902
sodium;[3-amino-4-oxo-4-[[(2S)-1-oxopropan-2-yl]amino]butyl]-methylphosphinous acid;hydride (PubChem CID 174273902) has the molecular formula C8H18N2NaO3P and a molecular weight of 244.21 g/mol. Its IUPAC name is sodium;[3-amino-4-oxo-4-[[(2S)-1-oxopropan-2-yl]amino]butyl]-methylphosphinous acid;hydride.
| Compound Name | sodium;[3-amino-4-oxo-4-[[(2S)-1-oxopropan-2-yl]amino]butyl]-methylphosphinous acid;hydride |
|---|---|
| PubChem CID | 174273902 |
| Molecular Formula | C8H18N2NaO3P |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | sodium;[3-amino-4-oxo-4-[[(2S)-1-oxopropan-2-yl]amino]butyl]-methylphosphinous acid;hydride |
| SMILES | C[C@@H](C=O)NC(=O)C(N)CCP(C)O.[H-].[Na+] |
| InChI | InChI=1S/C8H17N2O3P.Na.H/c1-6(5-11)10-8(12)7(9)3-4-14(2)13;;/h5-7,13H,3-4,9H2,1-2H3,(H,10,12);;/q;+1;-1/t6-,7?,14?;;/m0../s1 |
| InChIKey | ZDFLFOOJRDLXBL-HJTUVCQISA-N |
| XLogP | -3.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|