C10H21N3O2 — CID 57179994
(2R)-2,5-diamino-N-[(2R)-3-methyl-1-oxobutan-2-yl]pentanamide (PubChem CID 57179994) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-[(2R)-3-methyl-1-oxobutan-2-yl]pentanamide.
| Compound Name | (2R)-2,5-diamino-N-[(2R)-3-methyl-1-oxobutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 57179994 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | (2R)-2,5-diamino-N-[(2R)-3-methyl-1-oxobutan-2-yl]pentanamide |
| SMILES | CC(C)[C@H](C=O)NC(=O)[C@H](N)CCCN |
| InChI | InChI=1S/C10H21N3O2/c1-7(2)9(6-14)13-10(15)8(12)4-3-5-11/h6-9H,3-5,11-12H2,1-2H3,(H,13,15)/t8-,9+/m1/s1 |
| InChIKey | BSZZRTZPLMZNSL-BDAKNGLRSA-N |
| XLogP | -0.61 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|