C22H41N7O6 — CID 123632916
(4S)-4-[[(2S)-2-aminohexanoyl]amino]-5-[[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 123632916) has the molecular formula C22H41N7O6 and a molecular weight of 499.61 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-aminohexanoyl]amino]-5-[[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-aminohexanoyl]amino]-5-[[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123632916 |
| Molecular Formula | C22H41N7O6 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | (4S)-4-[[(2S)-2-aminohexanoyl]amino]-5-[[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-3-methyl-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCCC[C@H](N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@H](C=O)C(C)C |
| InChI | InChI=1S/C22H41N7O6/c1-4-5-7-14(23)19(33)27-16(9-10-18(31)32)21(35)28-15(8-6-11-26-22(24)25)20(34)29-17(12-30)13(2)3/h12-17H,4-11,23H2,1-3H3,(H,27,33)(H,28,35)(H,29,34)(H,31,32)(H4,24,25,26)/t14-,15-,16-,17+/m0/s1 |
| InChIKey | YRZPRWMSFRDDLT-LUKYLMHMSA-N |
| XLogP | -1.27 |
| TPSA | 232.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|