C15H29N3O3 — CID 174850502
(2R)-2,6-diamino-N-[(2S)-3-methyl-1-oxobutan-2-yl]-2-(2-methylpropanoyl)hexanamide (PubChem CID 174850502) has the molecular formula C15H29N3O3 and a molecular weight of 299.42 g/mol. Its IUPAC name is (2R)-2,6-diamino-N-[(2S)-3-methyl-1-oxobutan-2-yl]-2-(2-methylpropanoyl)hexanamide.
| Compound Name | (2R)-2,6-diamino-N-[(2S)-3-methyl-1-oxobutan-2-yl]-2-(2-methylpropanoyl)hexanamide |
|---|---|
| PubChem CID | 174850502 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (2R)-2,6-diamino-N-[(2S)-3-methyl-1-oxobutan-2-yl]-2-(2-methylpropanoyl)hexanamide |
| SMILES | CC(C)C(=O)[C@](N)(CCCCN)C(=O)N[C@H](C=O)C(C)C |
| InChI | InChI=1S/C15H29N3O3/c1-10(2)12(9-19)18-14(21)15(17,7-5-6-8-16)13(20)11(3)4/h9-12H,5-8,16-17H2,1-4H3,(H,18,21)/t12-,15-/m1/s1 |
| InChIKey | BRZIXZFSHIYGLT-IUODEOHRSA-N |
| XLogP | 0.38 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|