C12H24N2O2 — CID 118423165
2-(dimethylamino)-3-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]butanamide (PubChem CID 118423165) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-(dimethylamino)-3-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]butanamide.
| Compound Name | 2-(dimethylamino)-3-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]butanamide |
|---|---|
| PubChem CID | 118423165 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-(dimethylamino)-3-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]butanamide |
| SMILES | CC(C)C(C(=O)N[C@H](C=O)C(C)C)N(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-8(2)10(7-15)13-12(16)11(9(3)4)14(5)6/h7-11H,1-6H3,(H,13,16)/t10-,11?/m1/s1 |
| InChIKey | GCYIUVXHAKPYJK-NFJWQWPMSA-N |
| XLogP | 0.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|