C7H16N2OS — CID 166115605
2-(dimethylamino)-3-methyl-N-sulfanylbutanamide (PubChem CID 166115605) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is 2-(dimethylamino)-3-methyl-N-sulfanylbutanamide.
| Compound Name | 2-(dimethylamino)-3-methyl-N-sulfanylbutanamide |
|---|---|
| PubChem CID | 166115605 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-(dimethylamino)-3-methyl-N-sulfanylbutanamide |
| SMILES | CC(C)C(C(=O)NS)N(C)C |
| InChI | InChI=1S/C7H16N2OS/c1-5(2)6(9(3)4)7(10)8-11/h5-6,11H,1-4H3,(H,8,10) |
| InChIKey | YJDNOUCEOJFNLD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|