C11H24N4O2 — CID 143981855
2,5-diamino-N-[(5S)-5-amino-6-oxohexyl]pentanamide (PubChem CID 143981855) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2,5-diamino-N-[(5S)-5-amino-6-oxohexyl]pentanamide.
| Compound Name | 2,5-diamino-N-[(5S)-5-amino-6-oxohexyl]pentanamide |
|---|---|
| PubChem CID | 143981855 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2,5-diamino-N-[(5S)-5-amino-6-oxohexyl]pentanamide |
| SMILES | NCCCC(N)C(=O)NCCCC[C@H](N)C=O |
| InChI | InChI=1S/C11H24N4O2/c12-6-3-5-10(14)11(17)15-7-2-1-4-9(13)8-16/h8-10H,1-7,12-14H2,(H,15,17)/t9-,10?/m0/s1 |
| InChIKey | WPZYBKRRXDHVFE-RGURZIINSA-N |
| XLogP | -1.13 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|