C11H23N3O3 — CID 86308211
(2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid (PubChem CID 86308211) has the molecular formula C11H23N3O3 and a molecular weight of 245.32 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 86308211 |
| Molecular Formula | C11H23N3O3 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | (2R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C11H23N3O3/c1-7(2)9(11(16)17)14-10(15)8(13)5-3-4-6-12/h7-9H,3-6,12-13H2,1-2H3,(H,14,15)(H,16,17)/t8-,9+/m0/s1 |
| InChIKey | YQAIUOWPSUOINN-DTWKUNHWSA-N |
| XLogP | -0.33 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|